C23H26N2O5 — CID 156840921
2,3-dimethoxy-7-phenylmethoxy-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione (PubChem CID 156840921) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2,3-dimethoxy-7-phenylmethoxy-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione.
| Compound Name | 2,3-dimethoxy-7-phenylmethoxy-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione |
|---|---|
| PubChem CID | 156840921 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2,3-dimethoxy-7-phenylmethoxy-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione |
| SMILES | COC1c2cc(=O)c(OCc3ccccc3)c3n2C2(CCCCN(C2)C3=O)C1OC |
| InChI | InChI=1S/C23H26N2O5/c1-28-19-16-12-17(26)20(30-13-15-8-4-3-5-9-15)18-22(27)24-11-7-6-10-23(14-24,25(16)18)21(19)29-2/h3-5,8-9,12,19,21H,6-7,10-11,13-14H2,1-2H3 |
| InChIKey | CCNTXUYAORKVGZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |