C24H24F3N3O6 — CID 159809656
(1R,2R,3R)-7-hydroxy-2,3-dimethoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide (PubChem CID 159809656) has the molecular formula C24H24F3N3O6 and a molecular weight of 507.47 g/mol. Its IUPAC name is (1R,2R,3R)-7-hydroxy-2,3-dimethoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide.
| Compound Name | (1R,2R,3R)-7-hydroxy-2,3-dimethoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 159809656 |
| Molecular Formula | C24H24F3N3O6 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (1R,2R,3R)-7-hydroxy-2,3-dimethoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide |
| SMILES | CO[C@@H]1c2c(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(O)c3n2[C@@]2(CCCCN(C2)C3=O)[C@H]1OC |
| InChI | InChI=1S/C24H24F3N3O6/c1-35-20-16-15(22(33)28-9-12-13(26)7-11(25)8-14(12)27)18(31)19(32)17-23(34)29-6-4-3-5-24(10-29,30(16)17)21(20)36-2/h7-8,20-21,32H,3-6,9-10H2,1-2H3,(H,28,33)/t20-,21+,24-/m1/s1 |
| InChIKey | ATWPKWNTCPSORW-ZFGGDYGUSA-N |
| XLogP | 1.95 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |