C23H22F3N3O5 — CID 156840929
(1R)-7-hydroxy-3-methoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide (PubChem CID 156840929) has the molecular formula C23H22F3N3O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is (1R)-7-hydroxy-3-methoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide.
| Compound Name | (1R)-7-hydroxy-3-methoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 156840929 |
| Molecular Formula | C23H22F3N3O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (1R)-7-hydroxy-3-methoxy-6,9-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide |
| SMILES | COC1C[C@]23CCCCN(C2)C(=O)c2c(O)c(=O)c(C(=O)NCc4c(F)cc(F)cc4F)c1n23 |
| InChI | InChI=1S/C23H22F3N3O5/c1-34-15-8-23-4-2-3-5-28(10-23)22(33)18-20(31)19(30)16(17(15)29(18)23)21(32)27-9-12-13(25)6-11(24)7-14(12)26/h6-7,15,31H,2-5,8-10H2,1H3,(H,27,32)/t15?,23-/m1/s1 |
| InChIKey | XACLCRWDEKWJMH-RYDFDWSBSA-N |
| XLogP | 2.33 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |