C22H21F2N3O5 — CID 156840958
(1R,3S)-N-[(2,4-difluorophenyl)methyl]-3,7-dihydroxy-6,9-dioxo-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide (PubChem CID 156840958) has the molecular formula C22H21F2N3O5 and a molecular weight of 445.42 g/mol. Its IUPAC name is (1R,3S)-N-[(2,4-difluorophenyl)methyl]-3,7-dihydroxy-6,9-dioxo-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide.
| Compound Name | (1R,3S)-N-[(2,4-difluorophenyl)methyl]-3,7-dihydroxy-6,9-dioxo-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 156840958 |
| Molecular Formula | C22H21F2N3O5 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (1R,3S)-N-[(2,4-difluorophenyl)methyl]-3,7-dihydroxy-6,9-dioxo-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1c2n3c(c(O)c1=O)C(=O)N1CCCC[C@@]3(C[C@@H]2O)C1 |
| InChI | InChI=1S/C22H21F2N3O5/c23-12-4-3-11(13(24)7-12)9-25-20(31)15-16-14(28)8-22-5-1-2-6-26(10-22)21(32)17(27(16)22)19(30)18(15)29/h3-4,7,14,28,30H,1-2,5-6,8-10H2,(H,25,31)/t14-,22+/m0/s1 |
| InChIKey | XTGJUIFZHJBTEU-RCDICMHDSA-N |
| XLogP | 1.53 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |