C20H20FN3O5 — CID 147548514
N-[(4-fluorophenyl)methyl]-2,9-dihydroxy-4,6-dimethyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide (PubChem CID 147548514) has the molecular formula C20H20FN3O5 and a molecular weight of 401.39 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,9-dihydroxy-4,6-dimethyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,9-dihydroxy-4,6-dimethyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
|---|---|
| PubChem CID | 147548514 |
| Molecular Formula | C20H20FN3O5 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,9-dihydroxy-4,6-dimethyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
| SMILES | CN1CC2(C)CC(O)c3c(C(=O)NCc4ccc(F)cc4)c(=O)c(O)c(n32)C1=O |
| InChI | InChI=1S/C20H20FN3O5/c1-20-7-12(25)14-13(18(28)22-8-10-3-5-11(21)6-4-10)16(26)17(27)15(24(14)20)19(29)23(2)9-20/h3-6,12,25,27H,7-9H2,1-2H3,(H,22,28) |
| InChIKey | FQHRXQIHOIVMSB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |