C23H19F3N4O3S — CID 156840860
7-hydroxy-5-[5-[(2,4,6-trifluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione (PubChem CID 156840860) has the molecular formula C23H19F3N4O3S and a molecular weight of 488.49 g/mol. Its IUPAC name is 7-hydroxy-5-[5-[(2,4,6-trifluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione.
| Compound Name | 7-hydroxy-5-[5-[(2,4,6-trifluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione |
|---|---|
| PubChem CID | 156840860 |
| Molecular Formula | C23H19F3N4O3S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 7-hydroxy-5-[5-[(2,4,6-trifluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-10,15-diazatetracyclo[6.6.1.11,10.04,15]hexadeca-4,7-diene-6,9-dione |
| SMILES | O=C1c2c(O)c(=O)c(-c3nnc(Cc4c(F)cc(F)cc4F)s3)c3n2C2(CCCCN1C2)CC3 |
| InChI | InChI=1S/C23H19F3N4O3S/c24-11-7-13(25)12(14(26)8-11)9-16-27-28-21(34-16)17-15-3-5-23-4-1-2-6-29(10-23)22(33)18(30(15)23)20(32)19(17)31/h7-8,32H,1-6,9-10H2 |
| InChIKey | CCAQVXUPFNSYAT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |