C29H36IN6O3- — CID 156843358
CID 156843358 (PubChem CID 156843358) has the molecular formula C29H36IN6O3- and a molecular weight of 643.55 g/mol.
| Compound Name | CID 156843358 |
|---|---|
| PubChem CID | 156843358 |
| Molecular Formula | C29H36IN6O3- |
| Molecular Weight | 643.55 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CC2COCC1[I-]N2c1nc(OC[C@@H]2CCCN2C)nc2c1CN(C1CCc3ccccc31)C2 |
| InChI | InChI=1S/C29H36IN6O3/c1-3-27(37)35-13-21-16-38-18-26(35)30-36(21)28-23-14-34(25-11-10-19-7-4-5-9-22(19)25)15-24(23)31-29(32-28)39-17-20-8-6-12-33(20)2/h3-5,7,9,20-21,25-26H,1,6,8,10-18H2,2H3/q-1/t20-,21?,25?,26?/m0/s1 |
| InChIKey | UNIZAAXATDLCMJ-MAJNPEBDSA-N |
| XLogP | -0.48 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.55 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|