C29H36IN6O5S- — CID 156843447
CID 156843447 (PubChem CID 156843447) has the molecular formula C29H36IN6O5S- and a molecular weight of 707.62 g/mol.
| Compound Name | CID 156843447 |
|---|---|
| PubChem CID | 156843447 |
| Molecular Formula | C29H36IN6O5S- |
| Molecular Weight | 707.62 g/mol |
| Exact Mass | 707.15 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CC2CS(=O)(=O)CC1[I-]N2c1nc(O[C@@H]2CN(C)C[C@H]2OC)nc2c1CN(C1CCc3ccccc31)C2 |
| InChI | InChI=1S/C29H36IN6O5S/c1-4-27(37)35-11-19-16-42(38,39)17-26(35)30-36(19)28-21-12-34(23-10-9-18-7-5-6-8-20(18)23)13-22(21)31-29(32-28)41-25-15-33(2)14-24(25)40-3/h4-8,19,23-26H,1,9-17H2,2-3H3/q-1/t19?,23?,24-,25-,26?/m1/s1 |
| InChIKey | UILPPIUYVMLDLZ-ZNKNVWRLSA-N |
| XLogP | -1.85 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.62 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|