C21H25FN4O2 — CID 156843960
methyl 2-[(2,4-dimethylpyrimidine-5-carbonyl)amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]propanimidate (PubChem CID 156843960) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is methyl 2-[(2,4-dimethylpyrimidine-5-carbonyl)amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]propanimidate.
| Compound Name | methyl 2-[(2,4-dimethylpyrimidine-5-carbonyl)amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]propanimidate |
|---|---|
| PubChem CID | 156843960 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl 2-[(2,4-dimethylpyrimidine-5-carbonyl)amino]-N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]propanimidate |
| SMILES | CO/C(=N\C(=C(C)C)c1cccc(F)c1)C(C)NC(=O)c1cnc(C)nc1C |
| InChI | InChI=1S/C21H25FN4O2/c1-12(2)19(16-8-7-9-17(22)10-16)26-21(28-6)14(4)25-20(27)18-11-23-15(5)24-13(18)3/h7-11,14H,1-6H3,(H,25,27)/b26-21- |
| InChIKey | JVIYXWASMXGMNY-QLYXXIJNSA-N |
| XLogP | 3.85 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|