C26H34FN3O2 — CID 156843955
methyl N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-2-[[(Z)-2-[[(4Z,6Z)-octa-4,6-dien-3-ylidene]amino]but-2-enoyl]amino]propanimidate (PubChem CID 156843955) has the molecular formula C26H34FN3O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is methyl N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-2-[[(Z)-2-[[(4Z,6Z)-octa-4,6-dien-3-ylidene]amino]but-2-enoyl]amino]propanimidate.
| Compound Name | methyl N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-2-[[(Z)-2-[[(4Z,6Z)-octa-4,6-dien-3-ylidene]amino]but-2-enoyl]amino]propanimidate |
|---|---|
| PubChem CID | 156843955 |
| Molecular Formula | C26H34FN3O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | methyl N-[1-(3-fluorophenyl)-2-methylprop-1-enyl]-2-[[(Z)-2-[[(4Z,6Z)-octa-4,6-dien-3-ylidene]amino]but-2-enoyl]amino]propanimidate |
| SMILES | C/C=C\C=C/C(CC)=N/C(=C\C)C(=O)NC(C)/C(=N/C(=C(C)C)c1cccc(F)c1)OC |
| InChI | InChI=1S/C26H34FN3O2/c1-8-11-12-16-22(9-2)29-23(10-3)25(31)28-19(6)26(32-7)30-24(18(4)5)20-14-13-15-21(27)17-20/h8,10-17,19H,9H2,1-7H3,(H,28,31)/b11-8-,16-12-,23-10-,29-22+,30-26- |
| InChIKey | IALMSHQYZDJRMQ-AWCYZKMYSA-N |
| XLogP | 6.01 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|