C9H10ClIN3OP — CID 156844930
(Z,3E)-2-(6-chloro-2-methoxy-3-pyridinyl)-3-iodophosphanyliminoprop-1-en-1-amine (PubChem CID 156844930) has the molecular formula C9H10ClIN3OP and a molecular weight of 369.53 g/mol. Its IUPAC name is (Z,3E)-2-(6-chloro-2-methoxy-3-pyridinyl)-3-iodophosphanyliminoprop-1-en-1-amine.
| Compound Name | (Z,3E)-2-(6-chloro-2-methoxy-3-pyridinyl)-3-iodophosphanyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 156844930 |
| Molecular Formula | C9H10ClIN3OP |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | (Z,3E)-2-(6-chloro-2-methoxy-3-pyridinyl)-3-iodophosphanyliminoprop-1-en-1-amine |
| SMILES | COc1nc(Cl)ccc1C(=C/N)/C=N/PI |
| InChI | InChI=1S/C9H10ClIN3OP/c1-15-9-7(2-3-8(10)14-9)6(4-12)5-13-16-11/h2-5,16H,12H2,1H3/b6-4+,13-5+ |
| InChIKey | XFCAGGOMWIHZBI-XHTJEAMOSA-N |
| XLogP | 3.06 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|