C14H13BrIN4OP — CID 153348480
(Z,3E)-2-[4-(5-bromopyrazin-2-yl)-3-methoxyphenyl]-3-iodophosphanyliminoprop-1-en-1-amine (PubChem CID 153348480) has the molecular formula C14H13BrIN4OP and a molecular weight of 491.07 g/mol. Its IUPAC name is (Z,3E)-2-[4-(5-bromopyrazin-2-yl)-3-methoxyphenyl]-3-iodophosphanyliminoprop-1-en-1-amine.
| Compound Name | (Z,3E)-2-[4-(5-bromopyrazin-2-yl)-3-methoxyphenyl]-3-iodophosphanyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 153348480 |
| Molecular Formula | C14H13BrIN4OP |
| Molecular Weight | 491.07 g/mol |
| Exact Mass | 489.91 |
| IUPAC Name | (Z,3E)-2-[4-(5-bromopyrazin-2-yl)-3-methoxyphenyl]-3-iodophosphanyliminoprop-1-en-1-amine |
| SMILES | COc1cc(C(=C/N)/C=N/PI)ccc1-c1cnc(Br)cn1 |
| InChI | InChI=1S/C14H13BrIN4OP/c1-21-13-4-9(10(5-17)6-20-22-16)2-3-11(13)12-7-19-14(15)8-18-12/h2-8,22H,17H2,1H3/b10-5+,20-6+ |
| InChIKey | WSHGJWWJKDJJFY-ZVUCSSFCSA-N |
| XLogP | 4.23 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.07 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|