C7H14N2 — CID 156845031
3-methyl-1,8-diazabicyclo[3.2.1]octane (PubChem CID 156845031) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 3-methyl-1,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-methyl-1,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 156845031 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 3-methyl-1,8-diazabicyclo[3.2.1]octane |
| SMILES | CC1CC2CCN(C1)N2 |
| InChI | InChI=1S/C7H14N2/c1-6-4-7-2-3-9(5-6)8-7/h6-8H,2-5H2,1H3 |
| InChIKey | ZCVDXBVIECPFJO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |