C16H18O2 — CID 156845812
2-(2-benzyl-4-methylphenoxy)ethanol (PubChem CID 156845812) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(2-benzyl-4-methylphenoxy)ethanol.
| Compound Name | 2-(2-benzyl-4-methylphenoxy)ethanol |
|---|---|
| PubChem CID | 156845812 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(2-benzyl-4-methylphenoxy)ethanol |
| SMILES | Cc1ccc(OCCO)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H18O2/c1-13-7-8-16(18-10-9-17)15(11-13)12-14-5-3-2-4-6-14/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | NNDANDXPPCZBEB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |