C20H28NO2+ — CID 7375818
3-(2-benzyl-4-methylphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium (PubChem CID 7375818) has the molecular formula C20H28NO2+ and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-(2-benzyl-4-methylphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium.
| Compound Name | 3-(2-benzyl-4-methylphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7375818 |
| Molecular Formula | C20H28NO2+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3-(2-benzyl-4-methylphenoxy)propyl-[(2S)-2-hydroxypropyl]azanium |
| SMILES | Cc1ccc(OCCC[NH2+]C[C@H](C)O)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H27NO2/c1-16-9-10-20(23-12-6-11-21-15-17(2)22)19(13-16)14-18-7-4-3-5-8-18/h3-5,7-10,13,17,21-22H,6,11-12,14-15H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | RLNFCVQVCUBEIR-KRWDZBQOSA-O |
| XLogP | 2.30 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|