C12H17ClN2O — CID 156848717
3-chloro-2-[(3,3-dimethylpyrrolidin-2-yl)methoxy]pyridine (PubChem CID 156848717) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-chloro-2-[(3,3-dimethylpyrrolidin-2-yl)methoxy]pyridine.
| Compound Name | 3-chloro-2-[(3,3-dimethylpyrrolidin-2-yl)methoxy]pyridine |
|---|---|
| PubChem CID | 156848717 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-chloro-2-[(3,3-dimethylpyrrolidin-2-yl)methoxy]pyridine |
| SMILES | CC1(C)CCNC1COc1ncccc1Cl |
| InChI | InChI=1S/C12H17ClN2O/c1-12(2)5-7-14-10(12)8-16-11-9(13)4-3-6-15-11/h3-4,6,10,14H,5,7-8H2,1-2H3 |
| InChIKey | KDSYXMKGJPQWOJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |