C34H47Cl2N5O4S — CID 156849602
tert-butyl N-[2-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]ethyliminomethyl]carbamate;tert-butyl N-methylcarbamate (PubChem CID 156849602) has the molecular formula C34H47Cl2N5O4S and a molecular weight of 692.75 g/mol. Its IUPAC name is tert-butyl N-[2-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]ethyliminomethyl]carbamate;tert-butyl N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]ethyliminomethyl]carbamate;tert-butyl N-methylcarbamate |
|---|---|
| PubChem CID | 156849602 |
| Molecular Formula | C34H47Cl2N5O4S |
| Molecular Weight | 692.75 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | tert-butyl N-[2-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]ethyliminomethyl]carbamate;tert-butyl N-methylcarbamate |
| SMILES | CC(C)Cc1sc(N(CC/N=C/NC(=O)OC(C)(C)C)Cc2ccccc2)nc1-c1ccc(Cl)c(Cl)c1.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34Cl2N4O2S.C6H13NO2/c1-19(2)15-24-25(21-11-12-22(29)23(30)16-21)33-26(37-24)34(17-20-9-7-6-8-10-20)14-13-31-18-32-27(35)36-28(3,4)5;1-6(2,3)9-5(8)7-4/h6-12,16,18-19H,13-15,17H2,1-5H3,(H,31,32,35);1-4H3,(H,7,8) |
| InChIKey | KPTABCASFNSPLR-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.75 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|