C25H30Cl2N4OS2 — CID 156850000
N-(2-aminoethylsulfanyl)-3-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]propanamide (PubChem CID 156850000) has the molecular formula C25H30Cl2N4OS2 and a molecular weight of 537.58 g/mol. Its IUPAC name is N-(2-aminoethylsulfanyl)-3-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]propanamide.
| Compound Name | N-(2-aminoethylsulfanyl)-3-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 156850000 |
| Molecular Formula | C25H30Cl2N4OS2 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-(2-aminoethylsulfanyl)-3-[benzyl-[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]amino]propanamide |
| SMILES | CC(C)Cc1sc(N(CCC(=O)NSCCN)Cc2ccccc2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H30Cl2N4OS2/c1-17(2)14-22-24(19-8-9-20(26)21(27)15-19)29-25(34-22)31(16-18-6-4-3-5-7-18)12-10-23(32)30-33-13-11-28/h3-9,15,17H,10-14,16,28H2,1-2H3,(H,30,32) |
| InChIKey | BFDGGPDFHGRHIK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|