C22H31Cl2N3O2S — CID 166023459
3-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]-[4-(dimethylamino)butyl]amino]propanoic acid (PubChem CID 166023459) has the molecular formula C22H31Cl2N3O2S and a molecular weight of 472.48 g/mol. Its IUPAC name is 3-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]-[4-(dimethylamino)butyl]amino]propanoic acid.
| Compound Name | 3-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]-[4-(dimethylamino)butyl]amino]propanoic acid |
|---|---|
| PubChem CID | 166023459 |
| Molecular Formula | C22H31Cl2N3O2S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[[4-(3,4-dichlorophenyl)-5-(2-methylpropyl)-1,3-thiazol-2-yl]-[4-(dimethylamino)butyl]amino]propanoic acid |
| SMILES | CC(C)Cc1sc(N(CCCCN(C)C)CCC(=O)O)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H31Cl2N3O2S/c1-15(2)13-19-21(16-7-8-17(23)18(24)14-16)25-22(30-19)27(12-9-20(28)29)11-6-5-10-26(3)4/h7-8,14-15H,5-6,9-13H2,1-4H3,(H,28,29) |
| InChIKey | BBDNONOSHXTRNX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|