C10H17N5 — CID 156850066
N,N'-diamino-3-(benzylamino)propanimidamide (PubChem CID 156850066) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is N,N'-diamino-3-(benzylamino)propanimidamide.
| Compound Name | N,N'-diamino-3-(benzylamino)propanimidamide |
|---|---|
| PubChem CID | 156850066 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | N,N'-diamino-3-(benzylamino)propanimidamide |
| SMILES | N/N=C(/CCNCc1ccccc1)NN |
| InChI | InChI=1S/C10H17N5/c11-14-10(15-12)6-7-13-8-9-4-2-1-3-5-9/h1-5,13H,6-8,11-12H2,(H,14,15) |
| InChIKey | YJYRHAKRMGBRIU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|