C21H29N5O3 — CID 156851544
N-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-[[2-[3-(3-hydroxyphenyl)propylamino]acetyl]amino]propanamide (PubChem CID 156851544) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-[[2-[3-(3-hydroxyphenyl)propylamino]acetyl]amino]propanamide.
| Compound Name | N-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-[[2-[3-(3-hydroxyphenyl)propylamino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 156851544 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-[[2-[3-(3-hydroxyphenyl)propylamino]acetyl]amino]propanamide |
| SMILES | Cc1nc(N)ccc1CNC(=O)C(C)NC(=O)CNCCCc1cccc(O)c1 |
| InChI | InChI=1S/C21H29N5O3/c1-14-17(8-9-19(22)25-14)12-24-21(29)15(2)26-20(28)13-23-10-4-6-16-5-3-7-18(27)11-16/h3,5,7-9,11,15,23,27H,4,6,10,12-13H2,1-2H3,(H2,22,25)(H,24,29)(H,26,28) |
| InChIKey | SFIVCLZRXLZVRS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|