C18H15NO3S2 — CID 156852710
[2-[(5-methoxy-1,3-benzothiazol-2-yl)sulfanylmethyl]phenyl] prop-2-enoate (PubChem CID 156852710) has the molecular formula C18H15NO3S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is [2-[(5-methoxy-1,3-benzothiazol-2-yl)sulfanylmethyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(5-methoxy-1,3-benzothiazol-2-yl)sulfanylmethyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 156852710 |
| Molecular Formula | C18H15NO3S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | [2-[(5-methoxy-1,3-benzothiazol-2-yl)sulfanylmethyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1CSc1nc2cc(OC)ccc2s1 |
| InChI | InChI=1S/C18H15NO3S2/c1-3-17(20)22-15-7-5-4-6-12(15)11-23-18-19-14-10-13(21-2)8-9-16(14)24-18/h3-10H,1,11H2,2H3 |
| InChIKey | QFXZAMMKMREBMS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|