C14H26N6 — CID 156857442
ethane;5-ethanimidoyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 156857442) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is ethane;5-ethanimidoyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | ethane;5-ethanimidoyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 156857442 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | ethane;5-ethanimidoyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCN(C)CC1 |
| InChI | InChI=1S/C12H20N6.C2H6/c1-8(13)10-11(14)15-7-16-12(10)17-9-3-5-18(2)6-4-9;1-2/h7,9,13H,3-6H2,1-2H3,(H3,14,15,16,17);1-2H3/b13-8+; |
| InChIKey | CXCPRXFSKWUPTM-FNXZNAJJSA-N |
| XLogP | 1.98 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|