C31H36ClN5O9 — CID 156861161
[(2R,3S,5R)-5-[2-chloro-6-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylamino]purin-9-yl]-2-(hydroxymethyl)-2-methyloxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 156861161) has the molecular formula C31H36ClN5O9 and a molecular weight of 658.11 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2-chloro-6-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylamino]purin-9-yl]-2-(hydroxymethyl)-2-methyloxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | [(2R,3S,5R)-5-[2-chloro-6-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylamino]purin-9-yl]-2-(hydroxymethyl)-2-methyloxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 156861161 |
| Molecular Formula | C31H36ClN5O9 |
| Molecular Weight | 658.11 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | [(2R,3S,5R)-5-[2-chloro-6-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylamino]purin-9-yl]-2-(hydroxymethyl)-2-methyloxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | CC(=O)Oc1cc(C)cc(C)c1C(C)(C)CC(=O)O[C@H]1C[C@H](n2cnc3c(NCc4oc(=O)oc4C)nc(Cl)nc32)O[C@]1(C)CO |
| InChI | InChI=1S/C31H36ClN5O9/c1-15-8-16(2)24(19(9-15)43-18(4)39)30(5,6)11-23(40)45-21-10-22(46-31(21,7)13-38)37-14-34-25-26(35-28(32)36-27(25)37)33-12-20-17(3)42-29(41)44-20/h8-9,14,21-22,38H,10-13H2,1-7H3,(H,33,35,36)/t21-,22+,31+/m0/s1 |
| InChIKey | SNQLPXZZJQVLDH-BTOMHAHJSA-N |
| XLogP | 4.44 |
| TPSA | 181.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.11 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|