C19H17F3N2O5 — CID 156861356
(3aS,4S,5S,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxy-4,7-dimethyl-1-oxo-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindole-5-carboxylic acid (PubChem CID 156861356) has the molecular formula C19H17F3N2O5 and a molecular weight of 410.35 g/mol. Its IUPAC name is (3aS,4S,5S,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxy-4,7-dimethyl-1-oxo-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindole-5-carboxylic acid.
| Compound Name | (3aS,4S,5S,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxy-4,7-dimethyl-1-oxo-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 156861356 |
| Molecular Formula | C19H17F3N2O5 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (3aS,4S,5S,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-3-hydroxy-4,7-dimethyl-1-oxo-3a,5,6,7a-tetrahydro-3H-4,7-epoxyisoindole-5-carboxylic acid |
| SMILES | C[C@@]12O[C@@](C)(C[C@@H]1C(=O)O)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(O)[C@@H]12 |
| InChI | InChI=1S/C19H17F3N2O5/c1-17-6-11(16(27)28)18(2,29-17)13-12(17)14(25)24(15(13)26)9-4-3-8(7-23)10(5-9)19(20,21)22/h3-5,11-13,15,26H,6H2,1-2H3,(H,27,28)/t11-,12+,13-,15?,17+,18-/m1/s1 |
| InChIKey | GKTVTMCQQNPZFL-BWHGQXCESA-N |
| XLogP | 2.13 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |