C8H10O4 — CID 15686145
4-ethenyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 15686145) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 4-ethenyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-ethenyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15686145 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-ethenyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | C=CC1(O)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C8H10O4/c1-4-8(10)6(9)5(11-2)7(8)12-3/h4,10H,1H2,2-3H3 |
| InChIKey | TZJNWQHEQATZNB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|