C23H19ClN4O3 — CID 156861573
4-[[5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carbonyl]amino]butanoic acid (PubChem CID 156861573) has the molecular formula C23H19ClN4O3 and a molecular weight of 434.88 g/mol. Its IUPAC name is 4-[[5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 156861573 |
| Molecular Formula | C23H19ClN4O3 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-[[5-(3-chloroanilino)benzo[c][2,6]naphthyridine-8-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1ccc2c(c1)nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C23H19ClN4O3/c24-15-3-1-4-16(12-15)27-22-18-8-10-25-13-19(18)17-7-6-14(11-20(17)28-22)23(31)26-9-2-5-21(29)30/h1,3-4,6-8,10-13H,2,5,9H2,(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | MDQGKWMQZFHMEF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|