C27H24ClNO — CID 15686504
[4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride (PubChem CID 15686504) has the molecular formula C27H24ClNO and a molecular weight of 413.95 g/mol. Its IUPAC name is [4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride.
| Compound Name | [4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 15686504 |
| Molecular Formula | C27H24ClNO |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride |
| SMILES | C[N+](C)=C1C=CC(=CC=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)C=C1.[Cl-] |
| InChI | InChI=1S/C27H24NO.ClH/c1-28(2)25-17-15-21(16-18-25)13-14-22-19-26(23-9-5-3-6-10-23)29-27(20-22)24-11-7-4-8-12-24;/h3-20H,1-2H3;1H/q+1;/p-1 |
| InChIKey | UVWQDRSVFCXQJO-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|