C19H20NO2+ — CID 91276437
diethyl-(4-hydroxy-2-phenylchromen-7-ylidene)azanium (PubChem CID 91276437) has the molecular formula C19H20NO2+ and a molecular weight of 294.37 g/mol. Its IUPAC name is diethyl-(4-hydroxy-2-phenylchromen-7-ylidene)azanium.
| Compound Name | diethyl-(4-hydroxy-2-phenylchromen-7-ylidene)azanium |
|---|---|
| PubChem CID | 91276437 |
| Molecular Formula | C19H20NO2+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | diethyl-(4-hydroxy-2-phenylchromen-7-ylidene)azanium |
| SMILES | CC[N+](CC)=c1ccc2c(O)cc(-c3ccccc3)oc-2c1 |
| InChI | InChI=1S/C19H19NO2/c1-3-20(4-2)15-10-11-16-17(21)13-18(22-19(16)12-15)14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3/p+1 |
| InChIKey | PHPLXLWRCQFJPZ-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 36.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|