C29H24F2NO+ — CID 154594299
[4-[(E,4E)-4-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]but-2-enylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 154594299) has the molecular formula C29H24F2NO+ and a molecular weight of 440.51 g/mol. Its IUPAC name is [4-[(E,4E)-4-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]but-2-enylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(E,4E)-4-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]but-2-enylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 154594299 |
| Molecular Formula | C29H24F2NO+ |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [4-[(E,4E)-4-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]but-2-enylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=C1C=CC(=C/C=C/C=C2\C=C(c3ccc(F)cc3)C=C(c3ccc(F)cc3)O2)C=C1 |
| InChI | InChI=1S/C29H24F2NO/c1-32(2)27-17-7-21(8-18-27)5-3-4-6-28-19-24(22-9-13-25(30)14-10-22)20-29(33-28)23-11-15-26(31)16-12-23/h3-20H,1-2H3/q+1/b4-3+,28-6+ |
| InChIKey | UTKUTRYYAAQWLW-HEUHNVDTSA-N |
| XLogP | 6.63 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|