C29H26BF6NO3 — CID 155524519
[4-[(2E)-2-[4,6-bis(3-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium tetrafluoroborate (PubChem CID 155524519) has the molecular formula C29H26BF6NO3 and a molecular weight of 561.33 g/mol. Its IUPAC name is [4-[(2E)-2-[4,6-bis(3-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium tetrafluoroborate.
| Compound Name | [4-[(2E)-2-[4,6-bis(3-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 155524519 |
| Molecular Formula | C29H26BF6NO3 |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | [4-[(2E)-2-[4,6-bis(3-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-bis(2-hydroxyethyl)azanium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.OCC[N+](CCO)=C1C=CC(=C/C=C2\C=C(c3cccc(F)c3)C=C(c3cccc(F)c3)O2)C=C1 |
| InChI | InChI=1S/C29H26F2NO3.BF4/c30-25-5-1-3-22(17-25)24-19-28(35-29(20-24)23-4-2-6-26(31)18-23)12-9-21-7-10-27(11-8-21)32(13-15-33)14-16-34;2-1(3,4)5/h1-12,17-20,33-34H,13-16H2;/q+1;-1/b28-12+; |
| InChIKey | UXZVHCTWJYZUNM-ZAJJSZMNSA-N |
| XLogP | 6.09 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|