C29H21F4N2O+ — CID 154594192
[4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium (PubChem CID 154594192) has the molecular formula C29H21F4N2O+ and a molecular weight of 489.49 g/mol. Its IUPAC name is [4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium.
| Compound Name | [4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium |
|---|---|
| PubChem CID | 154594192 |
| Molecular Formula | C29H21F4N2O+ |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium |
| SMILES | C[N+](CCC#N)=C1C=CC(=C/C=C2\C=C(c3ccc(F)c(F)c3)C=C(c3ccc(F)c(F)c3)O2)C=C1 |
| InChI | InChI=1S/C29H21F4N2O/c1-35(14-2-13-34)23-8-3-19(4-9-23)5-10-24-15-22(20-6-11-25(30)27(32)16-20)18-29(36-24)21-7-12-26(31)28(33)17-21/h3-12,15-18H,2,14H2,1H3/q+1/b19-5-,24-10+,35-23+ |
| InChIKey | DJYZSOOWXSAELP-IPRVEMJRSA-N |
| XLogP | 6.63 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|