C29H23F2N2O+ — CID 154594153
[4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium (PubChem CID 154594153) has the molecular formula C29H23F2N2O+ and a molecular weight of 453.51 g/mol. Its IUPAC name is [4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium.
| Compound Name | [4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium |
|---|---|
| PubChem CID | 154594153 |
| Molecular Formula | C29H23F2N2O+ |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-methylazanium |
| SMILES | C[N+](CCC#N)=C1C=CC(=C/C=C2\C=C(c3ccc(F)cc3)C=C(c3ccc(F)cc3)O2)C=C1 |
| InChI | InChI=1S/C29H23F2N2O/c1-33(18-2-17-32)27-14-3-21(4-15-27)5-16-28-19-24(22-6-10-25(30)11-7-22)20-29(34-28)23-8-12-26(31)13-9-23/h3-16,19-20H,2,18H2,1H3/q+1/b21-5-,28-16+,33-27+ |
| InChIKey | QZQYHRMMMSXAFG-DDMLHBEVSA-N |
| XLogP | 6.35 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|