C31H28F2NO+ — CID 154594206
(6E)-6-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-1-propyl-3,4-dihydro-2H-quinolin-1-ium (PubChem CID 154594206) has the molecular formula C31H28F2NO+ and a molecular weight of 468.57 g/mol. Its IUPAC name is (6E)-6-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-1-propyl-3,4-dihydro-2H-quinolin-1-ium.
| Compound Name | (6E)-6-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-1-propyl-3,4-dihydro-2H-quinolin-1-ium |
|---|---|
| PubChem CID | 154594206 |
| Molecular Formula | C31H28F2NO+ |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (6E)-6-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-1-propyl-3,4-dihydro-2H-quinolin-1-ium |
| SMILES | CCC[N+]1=c2cc/c(=C\C=C3/C=C(c4ccc(F)cc4)C=C(c4ccc(F)cc4)O3)cc2CCC1 |
| InChI | InChI=1S/C31H28F2NO/c1-2-17-34-18-3-4-25-19-22(6-16-30(25)34)5-15-29-20-26(23-7-11-27(32)12-8-23)21-31(35-29)24-9-13-28(33)14-10-24/h5-16,19-21H,2-4,17-18H2,1H3/q+1/b22-5+,29-15+ |
| InChIKey | RBCVUJNCJSUYLC-IEAYYLCDSA-N |
| XLogP | 5.63 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|