C29H26F2NO2+ — CID 154594087
[(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium (PubChem CID 154594087) has the molecular formula C29H26F2NO2+ and a molecular weight of 458.53 g/mol. Its IUPAC name is [(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium.
| Compound Name | [(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 154594087 |
| Molecular Formula | C29H26F2NO2+ |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-hydroxycyclohexa-2,5-dien-1-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=C1C=C/C(=C\C=C2/C=C(c3ccc(F)cc3)C=C(c3ccc(F)cc3)O2)C(O)=C1 |
| InChI | InChI=1S/C29H25F2NO2/c1-3-32(4-2)26-15-9-21(28(33)19-26)10-16-27-17-23(20-5-11-24(30)12-6-20)18-29(34-27)22-7-13-25(31)14-8-22/h5-19H,3-4H2,1-2H3/p+1/b21-10+,27-16+ |
| InChIKey | YILCZZMGBFFNPX-SFOIPHEPSA-O |
| XLogP | 6.73 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|