C27H20F4NO+ — CID 154594236
[4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 154594236) has the molecular formula C27H20F4NO+ and a molecular weight of 450.46 g/mol. Its IUPAC name is [4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 154594236 |
| Molecular Formula | C27H20F4NO+ |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [4-[(2E)-2-[4,6-bis(3,4-difluorophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=C1C=CC(=C/C=C2\C=C(c3ccc(F)c(F)c3)C=C(c3ccc(F)c(F)c3)O2)C=C1 |
| InChI | InChI=1S/C27H20F4NO/c1-32(2)21-8-3-17(4-9-21)5-10-22-13-20(18-6-11-23(28)25(30)14-18)16-27(33-22)19-7-12-24(29)26(31)15-19/h3-16H,1-2H3/q+1/b22-10+ |
| InChIKey | LZVLTVFCRNPRKF-LSHDLFTRSA-N |
| XLogP | 6.35 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|