C29H16BF10NO2 — CID 139186160
[4-[2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3-dioxa-2-boranuidacyclohex-5-en-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 139186160) has the molecular formula C29H16BF10NO2 and a molecular weight of 611.24 g/mol. Its IUPAC name is [4-[2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3-dioxa-2-boranuidacyclohex-5-en-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3-dioxa-2-boranuidacyclohex-5-en-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 139186160 |
| Molecular Formula | C29H16BF10NO2 |
| Molecular Weight | 611.24 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | [4-[2,2-bis(2,3,4,5,6-pentafluorophenyl)-6-phenyl-1,3-dioxa-2-boranuidacyclohex-5-en-4-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=C1C=CC(=C2C=C(c3ccccc3)O[B-](c3c(F)c(F)c(F)c(F)c3F)(c3c(F)c(F)c(F)c(F)c3F)O2)C=C1 |
| InChI | InChI=1S/C29H16BF10NO2/c1-41(2)15-10-8-14(9-11-15)17-12-16(13-6-4-3-5-7-13)42-30(43-17,18-20(31)24(35)28(39)25(36)21(18)32)19-22(33)26(37)29(40)27(38)23(19)34/h3-12H,1-2H3 |
| InChIKey | KURSGCPNQIDSSM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.24 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|