C31H27F2N2O+ — CID 154594305
[(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-ethylazanium (PubChem CID 154594305) has the molecular formula C31H27F2N2O+ and a molecular weight of 481.57 g/mol. Its IUPAC name is [(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-ethylazanium.
| Compound Name | [(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-ethylazanium |
|---|---|
| PubChem CID | 154594305 |
| Molecular Formula | C31H27F2N2O+ |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [(4E)-4-[(2E)-2-[4,6-bis(4-fluorophenyl)pyran-2-ylidene]ethylidene]-3-methylcyclohexa-2,5-dien-1-ylidene]-(2-cyanoethyl)-ethylazanium |
| SMILES | CC/[N+](CCC#N)=C1\C=C/C(=C\C=C2/C=C(c3ccc(F)cc3)C=C(c3ccc(F)cc3)O2)C(C)=C1 |
| InChI | InChI=1S/C31H27F2N2O/c1-3-35(18-4-17-34)29-15-9-23(22(2)19-29)10-16-30-20-26(24-5-11-27(32)12-6-24)21-31(36-30)25-7-13-28(33)14-8-25/h5-16,19-21H,3-4,18H2,1-2H3/q+1/b23-10+,30-16+,35-29- |
| InChIKey | XYZPXVRZBQDLJA-RPVNCSIMSA-N |
| XLogP | 7.13 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|