C17H12ClF3N4 — CID 156865281
N-(5-chloro-1H-indol-3-yl)-1-methyl-5-(trifluoromethyl)benzimidazol-2-amine (PubChem CID 156865281) has the molecular formula C17H12ClF3N4 and a molecular weight of 364.76 g/mol. Its IUPAC name is N-(5-chloro-1H-indol-3-yl)-1-methyl-5-(trifluoromethyl)benzimidazol-2-amine.
| Compound Name | N-(5-chloro-1H-indol-3-yl)-1-methyl-5-(trifluoromethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 156865281 |
| Molecular Formula | C17H12ClF3N4 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(5-chloro-1H-indol-3-yl)-1-methyl-5-(trifluoromethyl)benzimidazol-2-amine |
| SMILES | Cn1c(Nc2c[nH]c3ccc(Cl)cc23)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H12ClF3N4/c1-25-15-5-2-9(17(19,20)21)6-13(15)23-16(25)24-14-8-22-12-4-3-10(18)7-11(12)14/h2-8,22H,1H3,(H,23,24) |
| InChIKey | LAGIZHAUZUUHQS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |