About N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine
N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine (PubChem CID 167428718) has the molecular formula C21H16ClN5O
and a molecular weight of 389.85 g/mol. Its IUPAC name is N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine.
Molecular Properties
| Compound Name | N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine |
| PubChem CID | 167428718 |
| Molecular Formula | C21H16ClN5O |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine |
| SMILES | Cn1c(Nc2c[nH]c3ncc(Cl)cc23)nc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C21H16ClN5O/c1-27-19-10-15(28-14-5-3-2-4-6-14)7-8-17(19)25-21(27)26-18-12-24-20-16(18)9-13(22)11-23-20/h2-12H,1H3,(H,23,24)(H,25,26) |
| InChIKey | KYSRTFVSJBLYPR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine?
The IUPAC name of N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine (CID 167428718) is N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine.
What is the SMILES notation for N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine?
The canonical SMILES for N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine is Cn1c(Nc2c[nH]c3ncc(Cl)cc23)nc2ccc(Oc3ccccc3)cc21.
What is the InChIKey of N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine?
The InChIKey is KYSRTFVSJBLYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClN5O/c1-27-19-10-15(28-14-5-3-2-4-6-14)7-8-17(19)25-21(27)26-18-12-24-20-16(18)9-13(22)11-23-20/h2-12H,1H3,(H,23,24)(H,25,26).
What are the key properties of N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine?
N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine has a molecular weight of 389.85 g/mol, XLogP of 5.64, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1-methyl-6-phenoxybenzimidazol-2-amine is sourced from PubChem (CID 167428718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).