C15H23F3O5 — CID 156865306
ethyl 2-butoxy-4-ethoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 156865306) has the molecular formula C15H23F3O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl 2-butoxy-4-ethoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl 2-butoxy-4-ethoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 156865306 |
| Molecular Formula | C15H23F3O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl 2-butoxy-4-ethoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | CCCCOC1CC(OCC)C(C(=O)OCC)=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C15H23F3O5/c1-4-7-8-22-11-9-10(20-5-2)12(14(19)21-6-3)13(23-11)15(16,17)18/h10-11H,4-9H2,1-3H3 |
| InChIKey | PSPQBIFSHGOXGP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|