C19H31F3O5 — CID 156865300
ethyl 4-ethoxy-2-octoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 156865300) has the molecular formula C19H31F3O5 and a molecular weight of 396.45 g/mol. Its IUPAC name is ethyl 4-ethoxy-2-octoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl 4-ethoxy-2-octoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 156865300 |
| Molecular Formula | C19H31F3O5 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | ethyl 4-ethoxy-2-octoxy-6-(trifluoromethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | CCCCCCCCOC1CC(OCC)C(C(=O)OCC)=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C19H31F3O5/c1-4-7-8-9-10-11-12-26-15-13-14(24-5-2)16(18(23)25-6-3)17(27-15)19(20,21)22/h14-15H,4-13H2,1-3H3 |
| InChIKey | KVHOXHBLAMTDLX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|