C20H9F13N2O2 — CID 156866347
2-[4-[1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]phenyl]-1H-benzimidazole (PubChem CID 156866347) has the molecular formula C20H9F13N2O2 and a molecular weight of 556.28 g/mol. Its IUPAC name is 2-[4-[1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]phenyl]-1H-benzimidazole.
| Compound Name | 2-[4-[1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 156866347 |
| Molecular Formula | C20H9F13N2O2 |
| Molecular Weight | 556.28 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | 2-[4-[1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]phenyl]-1H-benzimidazole |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)c1ccc(-c2nc3ccccc3[nH]2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H9F13N2O2/c21-13(22)14(23)36-20(32,33)17(26,18(27,28)29)37-19(30,31)16(24,25)10-7-5-9(6-8-10)15-34-11-3-1-2-4-12(11)35-15/h1-8H,(H,34,35) |
| InChIKey | VADUSMDKZBHHNW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.28 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|