C23H49N3O — CID 156867142
4-[4-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepan-1-yl]-N,2,2,4-tetramethylpentan-1-amine (PubChem CID 156867142) has the molecular formula C23H49N3O and a molecular weight of 383.67 g/mol. Its IUPAC name is 4-[4-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepan-1-yl]-N,2,2,4-tetramethylpentan-1-amine.
| Compound Name | 4-[4-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepan-1-yl]-N,2,2,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 156867142 |
| Molecular Formula | C23H49N3O |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 383.39 |
| IUPAC Name | 4-[4-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepan-1-yl]-N,2,2,4-tetramethylpentan-1-amine |
| SMILES | CNCC(C)(C)CC(C)(C)N1CCCN(CC(C)(C)CC(C)(C)OC)CC1 |
| InChI | InChI=1S/C23H49N3O/c1-20(2,18-24-9)16-22(5,6)26-13-11-12-25(14-15-26)19-21(3,4)17-23(7,8)27-10/h24H,11-19H2,1-10H3 |
| InChIKey | MVUONQUTUJOZGH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |