C11H16N2O4 — CID 156867826
(3R)-1-[2-(prop-2-enoylamino)acetyl]piperidine-3-carboxylic acid (PubChem CID 156867826) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (3R)-1-[2-(prop-2-enoylamino)acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(prop-2-enoylamino)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 156867826 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (3R)-1-[2-(prop-2-enoylamino)acetyl]piperidine-3-carboxylic acid |
| SMILES | C=CC(=O)NCC(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H16N2O4/c1-2-9(14)12-6-10(15)13-5-3-4-8(7-13)11(16)17/h2,8H,1,3-7H2,(H,12,14)(H,16,17)/t8-/m1/s1 |
| InChIKey | NBXUROVKFDEVKW-MRVPVSSYSA-N |
| XLogP | -0.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|