molecular hydrogen;propane;pyridin-3-amine

C8H16N2 — CID 156868620

IUPACmolecular hydrogen;propane;pyridin-3-amine
SMILESCCC.Nc1cccnc1.[H][H]
InChIInChI=1S/C5H6N2.C3H8.H2/c6-5-2-1-3-7-4-5;1-3-2;/h1-4H,6H2;3H2,1-2H3;1H
InChIKeyKVAMUTQHAWRAOJ-UHFFFAOYSA-N
MW140.23 g/mol
LogP2.33
Rot. Bonds

About molecular hydrogen;propane;pyridin-3-amine

molecular hydrogen;propane;pyridin-3-amine (PubChem CID 156868620) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is molecular hydrogen;propane;pyridin-3-amine.

Molecular Properties

Compound Namemolecular hydrogen;propane;pyridin-3-amine
PubChem CID156868620
Molecular FormulaC8H16N2
Molecular Weight140.23 g/mol
Exact Mass140.13
IUPAC Namemolecular hydrogen;propane;pyridin-3-amine
SMILESCCC.Nc1cccnc1.[H][H]
InChIInChI=1S/C5H6N2.C3H8.H2/c6-5-2-1-3-7-4-5;1-3-2;/h1-4H,6H2;3H2,1-2H3;1H
InChIKeyKVAMUTQHAWRAOJ-UHFFFAOYSA-N
XLogP2.33
TPSA38.91 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.23
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;propane;pyridin-3-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;propane;pyridin-3-amine?
The IUPAC name of molecular hydrogen;propane;pyridin-3-amine (CID 156868620) is molecular hydrogen;propane;pyridin-3-amine.
What is the SMILES notation for molecular hydrogen;propane;pyridin-3-amine?
The canonical SMILES for molecular hydrogen;propane;pyridin-3-amine is CCC.Nc1cccnc1.[H][H].
What is the InChIKey of molecular hydrogen;propane;pyridin-3-amine?
The InChIKey is KVAMUTQHAWRAOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2.C3H8.H2/c6-5-2-1-3-7-4-5;1-3-2;/h1-4H,6H2;3H2,1-2H3;1H.
What are the key properties of molecular hydrogen;propane;pyridin-3-amine?
molecular hydrogen;propane;pyridin-3-amine has a molecular weight of 140.23 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;propane;pyridin-3-amine is sourced from PubChem (CID 156868620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).