C23H22N2O4 — CID 156868693
(1-ethoxy-3H-indene-4-carboximidoyl) 3-cyano-4-propan-2-yloxybenzoate (PubChem CID 156868693) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (1-ethoxy-3H-indene-4-carboximidoyl) 3-cyano-4-propan-2-yloxybenzoate.
| Compound Name | (1-ethoxy-3H-indene-4-carboximidoyl) 3-cyano-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 156868693 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (1-ethoxy-3H-indene-4-carboximidoyl) 3-cyano-4-propan-2-yloxybenzoate |
| SMILES | [H]/N=C(\OC(=O)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CC=C2OCC |
| InChI | InChI=1S/C23H22N2O4/c1-4-27-21-11-9-17-18(21)6-5-7-19(17)22(25)29-23(26)15-8-10-20(28-14(2)3)16(12-15)13-24/h5-8,10-12,14,25H,4,9H2,1-3H3/b25-22- |
| InChIKey | PIMUUSYIWHLFGW-LVWGJNHUSA-N |
| XLogP | 4.46 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|