C17H16ClN3O — CID 156870496
6-chloro-2-[(N,3-dimethylanilino)methyl]-3H-quinazolin-4-one (PubChem CID 156870496) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 6-chloro-2-[(N,3-dimethylanilino)methyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[(N,3-dimethylanilino)methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 156870496 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 6-chloro-2-[(N,3-dimethylanilino)methyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc(N(C)Cc2nc3ccc(Cl)cc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C17H16ClN3O/c1-11-4-3-5-13(8-11)21(2)10-16-19-15-7-6-12(18)9-14(15)17(22)20-16/h3-9H,10H2,1-2H3,(H,19,20,22) |
| InChIKey | AOGYFUWFIWUIOB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |