C12H10N4O3 — CID 156877075
2-[4-amino-5-(furan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]acetic acid (PubChem CID 156877075) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-[4-amino-5-(furan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]acetic acid.
| Compound Name | 2-[4-amino-5-(furan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]acetic acid |
|---|---|
| PubChem CID | 156877075 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[4-amino-5-(furan-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl]acetic acid |
| SMILES | Nc1ncnc2c1c(-c1ccoc1)cn2CC(=O)O |
| InChI | InChI=1S/C12H10N4O3/c13-11-10-8(7-1-2-19-5-7)3-16(4-9(17)18)12(10)15-6-14-11/h1-3,5-6H,4H2,(H,17,18)(H2,13,14,15) |
| InChIKey | ALUMZWFEJNRSAS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |