C16H18FN5O — CID 162365122
1-[4-amino-5-(4-amino-3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol (PubChem CID 162365122) has the molecular formula C16H18FN5O and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-[4-amino-5-(4-amino-3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-amino-5-(4-amino-3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 162365122 |
| Molecular Formula | C16H18FN5O |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[4-amino-5-(4-amino-3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)Cn1cc(-c2ccc(N)c(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C16H18FN5O/c1-16(2,23)7-22-6-10(9-3-4-12(18)11(17)5-9)13-14(19)20-8-21-15(13)22/h3-6,8,23H,7,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | JIBAKKYLJDYYOH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|